CAS 554-92-7 appears in our catalog under these names: Trimethobenzamide HCl, Trimethobenzamide Hydrochloride, >95% (HPLC), Trimethobenzamide Hydrochloride, Trimethobenzamide hydrochloride/ 100%, Trimethobenzamide Hydrochloride, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 10g, 1g, 250mg, 10mg, 50mg, 100mg, 500mg.
N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide;hydrochloride (CAS 554-92-7) is a chemical compound with the molecular formula C21H29ClN2O5 and a molecular weight of 424.9 g/mol. IUPAC name: N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide;hydrochloride. InChIKey: WIIZEEPFHXAUND-UHFFFAOYSA-N.
| Molecular formula | C21H29ClN2O5 |
|---|---|
| Molecular weight | 424.9 g/mol |
| IUPAC name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide;hydrochloride |
| InChIKey | WIIZEEPFHXAUND-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C(=C2)OC)OC)OC.Cl |
Computed by PubChem (NCBI)