CAS 55400-73-2 appears in our catalog under these names: 1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane, 95%, 1,11-Bis(methanesulfonyloxy)-3,6,9-trioxandecane, Ms–PEG4–Ms, Ms-PEG4-Ms 97%, ((Oxybis(ethane-2,1-diyl))bis(oxy))bis(ethane-2,1-diyl) dimethanesulfonate, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 2g, 500mg, 100mg, 50mg, 5 g.
2-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate (CAS 55400-73-2) is a chemical compound with the molecular formula C10H22O9S2 and a molecular weight of 350.4 g/mol. IUPAC name: 2-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate. InChIKey: GKMDADHKHXRPPF-UHFFFAOYSA-N.
| Molecular formula | C10H22O9S2 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate |
| InChIKey | GKMDADHKHXRPPF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOS(=O)(=O)C |
Computed by PubChem (NCBI)