CAS 55403-26-4 is the registry number for 3-Chloro-4-piperidin-1-yl-phenylamine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-chloro-4-piperidin-1-ylaniline (CAS 55403-26-4) is a chemical compound with the molecular formula C11H15ClN2 and a molecular weight of 210.70 g/mol. IUPAC name: 3-chloro-4-piperidin-1-ylaniline. InChIKey: NIGYLYWAEONQRX-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2 |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 3-chloro-4-piperidin-1-ylaniline |
| InChIKey | NIGYLYWAEONQRX-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)