CAS 55432-06-9 is the registry number for 4-(Chloromethyl)-3-(4-chlorophenyl)-1-phenyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
4-(chloromethyl)-3-(4-chlorophenyl)-1-phenylpyrazole (CAS 55432-06-9) is a chemical compound with the molecular formula C16H12Cl2N2 and a molecular weight of 303.2 g/mol. IUPAC name: 4-(chloromethyl)-3-(4-chlorophenyl)-1-phenylpyrazole. InChIKey: JNYLUNACJAOEIB-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 4-(chloromethyl)-3-(4-chlorophenyl)-1-phenylpyrazole |
| InChIKey | JNYLUNACJAOEIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)Cl)CCl |
Computed by PubChem (NCBI)