CAS 554405-20-8 appears in our catalog under these names: Bis(4-tert-butylphenyl)-1,3-thiazol-2-amine, 95%, Bis(4-tert-butylphenyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4,5-bis(4-tert-butylphenyl)-1,3-thiazol-2-amine (CAS 554405-20-8) is a chemical compound with the molecular formula C23H28N2S and a molecular weight of 364.5 g/mol. IUPAC name: 4,5-bis(4-tert-butylphenyl)-1,3-thiazol-2-amine. InChIKey: NVGFIKJZRWPKDF-UHFFFAOYSA-N.
| Molecular formula | C23H28N2S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 4,5-bis(4-tert-butylphenyl)-1,3-thiazol-2-amine |
| InChIKey | NVGFIKJZRWPKDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(SC(=N2)N)C3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)