Products 554414-59-4

CAS 554414-59-4 is the registry number for mPTP-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[(2S)-2,8-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decan-4-yl]acetic acid (CAS 554414-59-4) is a chemical compound with the molecular formula C23H27N3O3 and a molecular weight of 393.5 g/mol. IUPAC name: 2-[(2S)-2,8-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decan-4-yl]acetic acid. InChIKey: RTBSMPRMJIOMNX-FQEVSTJZSA-N.

Identity
Molecular formulaC23H27N3O3
Molecular weight393.5 g/mol
IUPAC name2-[(2S)-2,8-dibenzyl-3-oxo-1,4,8-triazaspiro[4.5]decan-4-yl]acetic acid
InChIKeyRTBSMPRMJIOMNX-FQEVSTJZSA-N
SMILESC1CN(CCC12N[C@H](C(=O)N2CC(=O)O)CC3=CC=CC=C3)CC4=CC=CC=C4

Computed by PubChem (NCBI)

Synonyms: orb3027552