Products 554423-03-9

CAS 554423-03-9 is the registry number for 2-Mercapto-3-methyl-3h-thieno[2,3-d]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 554423-03-9) is a chemical compound with the molecular formula C7H6N2OS2 and a molecular weight of 198.3 g/mol. IUPAC name: 3-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: YZHNKLQNNXOOMN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2OS2
Molecular weight198.3 g/mol
IUPAC name3-methyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one
InChIKeyYZHNKLQNNXOOMN-UHFFFAOYSA-N
SMILESCN1C(=O)C2=C(NC1=S)SC=C2

Computed by PubChem (NCBI)