CAS 554423-26-6 is the registry number for 5-(2-(Thiophen-2-yl)quinolin-4-yl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(2-thiophen-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 554423-26-6) is a chemical compound with the molecular formula C15H9N3OS2 and a molecular weight of 311.4 g/mol. IUPAC name: 5-(2-thiophen-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: MDFLBIKCAUPZQQ-UHFFFAOYSA-N.
| Molecular formula | C15H9N3OS2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 5-(2-thiophen-2-ylquinolin-4-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | MDFLBIKCAUPZQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CS3)C4=NNC(=S)O4 |
Computed by PubChem (NCBI)