CAS 55443-13-5 appears in our catalog under these names: Bucladesine Impurity 1, Adenosine Impurity (2'-O-MB-CAMP), 2'-O-Monobutyryladenosine-3', 5'-cyclic Monophosphate Sodium Salt, 2'-O-MB-cAMP sodium, 98%, 2'–O–MB–cAMP sodium. Offered by: Chemat Brand, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: on request, 1mg, 25mg, 10mg, 5mg, 50 mg, 25 mg, 5 mg.
Sodium [(4aR,6R,7R,7aR)-6-(6-aminopurin-9-yl)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate (CAS 55443-13-5) is a chemical compound with the molecular formula C14H17N5NaO7P and a molecular weight of 421.28 g/mol. IUPAC name: sodium [(4aR,6R,7R,7aR)-6-(6-aminopurin-9-yl)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate. InChIKey: GIHLXWZLZUNUHO-HOLUKZPASA-M.
| Molecular formula | C14H17N5NaO7P |
|---|---|
| Molecular weight | 421.28 g/mol |
| IUPAC name | sodium [(4aR,6R,7R,7aR)-6-(6-aminopurin-9-yl)-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl] butanoate |
| InChIKey | GIHLXWZLZUNUHO-HOLUKZPASA-M |
| SMILES | CCCC(=O)O[C@@H]1[C@H]2[C@@H](COP(=O)(O2)[O-])O[C@H]1N3C=NC4=C(N=CN=C43)N.[Na+] |
Computed by PubChem (NCBI)