CAS 554435-83-5 appears in our catalog under these names: Deferasirox Fe3+ chelate, Deferasirox fe3+ chelate, 95%, Deferasirox Fe3+ Chelate, Deferasirox (Fe3+ chelate), Deferasirox (Fe3+ chelate), 98.0%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 250mg, 10mg, 50mg, 25mg, 2mg, 100 mg.
4-[3,5-bis(2-oxidophenyl)-1,2,4-triazol-1-yl]benzoate;iron(3+) (CAS 554435-83-5) is a chemical compound with the molecular formula C21H12FeN3O4 and a molecular weight of 426.2 g/mol. IUPAC name: 4-[3,5-bis(2-oxidophenyl)-1,2,4-triazol-1-yl]benzoate;iron(3+). InChIKey: ABQALTGEPFNCIY-UHFFFAOYSA-K.
| Molecular formula | C21H12FeN3O4 |
|---|---|
| Molecular weight | 426.2 g/mol |
| IUPAC name | 4-[3,5-bis(2-oxidophenyl)-1,2,4-triazol-1-yl]benzoate;iron(3+) |
| InChIKey | ABQALTGEPFNCIY-UHFFFAOYSA-K |
| SMILES | C1=CC=C(C(=C1)C2=NN(C(=N2)C3=CC=CC=C3[O-])C4=CC=C(C=C4)C(=O)[O-])[O-].[Fe+3] |
Computed by PubChem (NCBI)