CAS 554438-52-7 appears in our catalog under these names: LASV inhibitor 3.3, 97%, LASV inhibitor 3·3, LASV inhibitor 3.3/ 99.55% (existing batch purity), N-(2-(4-(Diphenylmethyl)-1-piperazinyl)-2-oxoethyl)tricyclo(3.3.1.13,7)decane-1-carboxamide, LASV inhibitor 3.3. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 2mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]adamantane-1-carboxamide (CAS 554438-52-7) is a chemical compound with the molecular formula C30H37N3O2 and a molecular weight of 471.6 g/mol. IUPAC name: N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]adamantane-1-carboxamide. InChIKey: CUSOKWBOIRFXDP-UHFFFAOYSA-N.
| Molecular formula | C30H37N3O2 |
|---|---|
| Molecular weight | 471.6 g/mol |
| IUPAC name | N-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]adamantane-1-carboxamide |
| InChIKey | CUSOKWBOIRFXDP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)CNC(=O)C45CC6CC(C4)CC(C6)C5 |
Computed by PubChem (NCBI)