Products 55447-98-8

CAS 55447-98-8 is the registry number for 2,5-Bis(methoxycarbonyl)benzenesulfonic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-bis(methoxycarbonyl)benzenesulfonic acid (CAS 55447-98-8) is a chemical compound with the molecular formula C10H10O7S and a molecular weight of 274.25 g/mol. IUPAC name: 2,5-bis(methoxycarbonyl)benzenesulfonic acid. InChIKey: UOOQUQHTCHZDLK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O7S
Molecular weight274.25 g/mol
IUPAC name2,5-bis(methoxycarbonyl)benzenesulfonic acid
InChIKeyUOOQUQHTCHZDLK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)C(=O)OC)S(=O)(=O)O

Computed by PubChem (NCBI)