CAS 555-25-9 appears in our catalog under these names: N-(4-(N-(2,6-Dimethoxypyrimidin-4-yl)sulfamoyl)phenyl)acetamide, 98%, Sulfadimethoxine N4-Acetate, >95% (HPLC), N4-Acetylsulfadimethoxine. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 500mg, 5g, 100mg, 25mg.
N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide (CAS 555-25-9) is a chemical compound with the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. IUPAC name: N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide. InChIKey: WIYOSEJTAADVPJ-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O5S |
|---|---|
| Molecular weight | 352.37 g/mol |
| IUPAC name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | WIYOSEJTAADVPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=NC(=N2)OC)OC |
Computed by PubChem (NCBI)