CAS 555-90-8 appears in our catalog under these names: Nicotinaldehyde Thiosemicarbazone, Pyridine-3-carboxaldehyde Thiosemicarbazone. Offered by: Mikromol, LoGiCal, TRC. Available pack sizes: 100mg, 10mg, 250mg.
[(E)-pyridin-3-ylmethylideneamino]thiourea (CAS 555-90-8) is a chemical compound with the molecular formula C7H8N4S and a molecular weight of 180.23 g/mol. IUPAC name: [(E)-pyridin-3-ylmethylideneamino]thiourea. InChIKey: ABWLRVJYVVQTGQ-BJMVGYQFSA-N.
| Molecular formula | C7H8N4S |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | [(E)-pyridin-3-ylmethylideneamino]thiourea |
| InChIKey | ABWLRVJYVVQTGQ-BJMVGYQFSA-N |
| SMILES | C1=CC(=CN=C1)/C=N/NC(=S)N |
Computed by PubChem (NCBI)