Products 55502-53-9

CAS 55502-53-9 appears in our catalog under these names: 2,3,4,5,6-Pentafluorophenoxyacetyl chloride, 95%, 2-(Perfluorophenoxy)acetyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride (CAS 55502-53-9) is a chemical compound with the molecular formula C8H2ClF5O2 and a molecular weight of 260.54 g/mol. IUPAC name: 2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride. InChIKey: WQLJMPAQIWVNGS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H2ClF5O2
Molecular weight260.54 g/mol
IUPAC name2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride
InChIKeyWQLJMPAQIWVNGS-UHFFFAOYSA-N
SMILESC(C(=O)Cl)OC1=C(C(=C(C(=C1F)F)F)F)F

Computed by PubChem (NCBI)