CAS 55502-53-9 appears in our catalog under these names: 2,3,4,5,6-Pentafluorophenoxyacetyl chloride, 95%, 2-(Perfluorophenoxy)acetyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride (CAS 55502-53-9) is a chemical compound with the molecular formula C8H2ClF5O2 and a molecular weight of 260.54 g/mol. IUPAC name: 2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride. InChIKey: WQLJMPAQIWVNGS-UHFFFAOYSA-N.
| Molecular formula | C8H2ClF5O2 |
|---|---|
| Molecular weight | 260.54 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride |
| InChIKey | WQLJMPAQIWVNGS-UHFFFAOYSA-N |
| SMILES | C(C(=O)Cl)OC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)