CAS 5552-46-5 appears in our catalog under these names: 6-Iodo-8-nitroquinoline, 97%, 97%, 6-Iodo-8-nitroquinoline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-iodo-8-nitroquinoline (CAS 5552-46-5) is a chemical compound with the molecular formula C9H5IN2O2 and a molecular weight of 300.05 g/mol. IUPAC name: 6-iodo-8-nitroquinoline. InChIKey: MNONEVLFFGBYHO-UHFFFAOYSA-N.
| Molecular formula | C9H5IN2O2 |
|---|---|
| Molecular weight | 300.05 g/mol |
| IUPAC name | 6-iodo-8-nitroquinoline |
| InChIKey | MNONEVLFFGBYHO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)