CAS 55526-70-0 is the registry number for O,O-Bis(4-chlorophenyl) Phosphorochloridothioate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
Chloro-bis(4-chlorophenoxy)-sulfanylidene-lambda5-phosphane (CAS 55526-70-0) is a chemical compound with the molecular formula C12H8Cl3O2PS and a molecular weight of 353.6 g/mol. IUPAC name: chloro-bis(4-chlorophenoxy)-sulfanylidene-lambda5-phosphane. InChIKey: WZQOSDILQMXCPR-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3O2PS |
|---|---|
| Molecular weight | 353.6 g/mol |
| IUPAC name | chloro-bis(4-chlorophenoxy)-sulfanylidene-lambda5-phosphane |
| InChIKey | WZQOSDILQMXCPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OP(=S)(OC2=CC=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)