CAS 5556-13-8 appears in our catalog under these names: 4,4'-Dibromo-3,3'-bithiophene, 95%, 4,4'–Dibromo–3,3'–bithiophene, 4,4'-Dibromo-3,3'-bithiophene, >98.0%(GC), 4,4'-Dibromo-3,3'-bithiophene 98%, 4,4'-Dibromo-3,3'-bithiophene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-bromo-4-(4-bromothiophen-3-yl)thiophene (CAS 5556-13-8) is a chemical compound with the molecular formula C8H4Br2S2 and a molecular weight of 324.1 g/mol. IUPAC name: 3-bromo-4-(4-bromothiophen-3-yl)thiophene. InChIKey: QAVREGJMFYCNKD-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2S2 |
|---|---|
| Molecular weight | 324.1 g/mol |
| IUPAC name | 3-bromo-4-(4-bromothiophen-3-yl)thiophene |
| InChIKey | QAVREGJMFYCNKD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)Br)C2=CSC=C2Br |
Computed by PubChem (NCBI)