Products 55604-88-1
CAS 55604-88-1 is the registry number for 1-Oxo-4-hydroxy-2-en-4-ethylcyclohexa-5,8-olide. Offered by: MedChemExpress. Available pack sizes: Get quote.
3a-hydroxy-7,7a-dihydro-3H-1-benzofuran-2,6-dione (CAS 55604-88-1) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 3a-hydroxy-7,7a-dihydro-3H-1-benzofuran-2,6-dione. InChIKey: USTIRZSUTZHBAK-UHFFFAOYSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3a-hydroxy-7,7a-dihydro-3H-1-benzofuran-2,6-dione |
| InChIKey | USTIRZSUTZHBAK-UHFFFAOYSA-N |
| SMILES | C1C2C(CC(=O)O2)(C=CC1=O)O |
Computed by PubChem (NCBI)