CAS 5562-52-7 appears in our catalog under these names: 3-Benzoylpiperidine hydrochloride, 98%, 3-Benzoylpiperidine HCl, 98%, 3-Benzoylpiperidine HCl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 2,5g.
Phenyl(piperidin-3-yl)methanone;hydrochloride (CAS 5562-52-7) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: phenyl(piperidin-3-yl)methanone;hydrochloride. InChIKey: MNODEQCNDLADAL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | phenyl(piperidin-3-yl)methanone;hydrochloride |
| InChIKey | MNODEQCNDLADAL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)