Products 55620-23-0

CAS 55620-23-0 is the registry number for 1-(methylsulfinyl)ethan-1-one O-methylcarbamoyl oxime. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(Z)-1-methylsulfinylethylideneamino] N-methylcarbamate (CAS 55620-23-0) is a chemical compound with the molecular formula C5H10N2O3S and a molecular weight of 178.21 g/mol. IUPAC name: [(Z)-1-methylsulfinylethylideneamino] N-methylcarbamate. InChIKey: TZPTVLNJSLZVEI-DAXSKMNVSA-N.

Identity
Molecular formulaC5H10N2O3S
Molecular weight178.21 g/mol
IUPAC name[(Z)-1-methylsulfinylethylideneamino] N-methylcarbamate
InChIKeyTZPTVLNJSLZVEI-DAXSKMNVSA-N
SMILESC/C(=N/OC(=O)NC)/S(=O)C

Computed by PubChem (NCBI)