Products 55621-88-0
CAS 55621-88-0 appears in our catalog under these names: Fe(iii) meso-tetra (4-pyridyl) porphine chloride, 95%, Fe(III) meso-Tetra (4-pyridyl) Porphine Chloride, 95%, 95%, Fe(III) meso-Tetra(4-pyridyl)porphine chloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Iron(3+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide;chloride (CAS 55621-88-0) is a chemical compound with the molecular formula C40H24ClFeN8 and a molecular weight of 708.0 g/mol. IUPAC name: iron(3+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide;chloride. InChIKey: XZXFYYWPPLFOLM-UHFFFAOYSA-M.
| Molecular formula | C40H24ClFeN8 |
|---|---|
| Molecular weight | 708.0 g/mol |
| IUPAC name | iron(3+);5,10,15,20-tetrapyridin-4-ylporphyrin-22,24-diide;chloride |
| InChIKey | XZXFYYWPPLFOLM-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C3=NC(=C(C4=CC=C([N-]4)C(=C5C=CC(=N5)C(=C1[N-]2)C6=CC=NC=C6)C7=CC=NC=C7)C8=CC=NC=C8)C=C3)C9=CC=NC=C9.[Cl-].[Fe+3] |
Computed by PubChem (NCBI)