CAS 55627-73-1 appears in our catalog under these names: 8-Bromoinosine, 95%, 8–Bromoinsine, 8-Bromoinosine. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg, 500mg.
8-bromo-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 55627-73-1) is a chemical compound with the molecular formula C10H11BrN4O5 and a molecular weight of 347.12 g/mol. IUPAC name: 8-bromo-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: XCAXTILLADBPII-UUOKFMHZSA-N.
| Molecular formula | C10H11BrN4O5 |
|---|---|
| Molecular weight | 347.12 g/mol |
| IUPAC name | 8-bromo-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | XCAXTILLADBPII-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=C(N2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)Br |
Computed by PubChem (NCBI)