CAS 55628-54-1 appears in our catalog under these names: 3,4,6–Tri–O–benzyl–D–glucal, 3,4,6-Tri-O-benzyl-D-glucal, 97% , 3,4,6-Tri-O-benzyl-D-glucal, Tri-O-benzyl-D-glucal, >95.0%(HPLC), Tri-O-benzyl-D-glucal 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 250g, 100g, 250mg.
(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran (CAS 55628-54-1) is a chemical compound with the molecular formula C27H28O4 and a molecular weight of 416.5 g/mol. IUPAC name: (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran. InChIKey: MXYLLYBWXIUMIT-PFBJBMPXSA-N.
| Molecular formula | C27H28O4 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
| InChIKey | MXYLLYBWXIUMIT-PFBJBMPXSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@@H](C=CO2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)