CAS 55636-09-4 appears in our catalog under these names: 2-hydroxy-N1,N1,N1,N3,N3,N3-hexamethylpropane-1,3-diaminium chloride, 2-Hydroxy-N1,N1,N1,N3,N3,N3-hexamethylpropane-1,3-diaminium chloride 97%, 2-Hydroxy-N1,N1,N1,N3,N3,N3-hexamethylpropane-1,3-diaminium chloride, 97%, 97%, 2-Hydroxy-N1,N1,N1,N3,N3,N3-hexamethylpropane-1,3-diaminium chloride, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 25g.
[2-hydroxy-3-(trimethylazaniumyl)propyl]-trimethylazanium dichloride (CAS 55636-09-4) is a chemical compound with the molecular formula C9H24Cl2N2O and a molecular weight of 247.20 g/mol. IUPAC name: [2-hydroxy-3-(trimethylazaniumyl)propyl]-trimethylazanium dichloride. InChIKey: UIYQPSXVBLBPQP-UHFFFAOYSA-L.
| Molecular formula | C9H24Cl2N2O |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | [2-hydroxy-3-(trimethylazaniumyl)propyl]-trimethylazanium dichloride |
| InChIKey | UIYQPSXVBLBPQP-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CC(C[N+](C)(C)C)O.[Cl-].[Cl-] |
Computed by PubChem (NCBI)