CAS 55644-08-1 is the registry number for Dimethylbis(alpha-bromoisopropyl)silane. Offered by: TRC. Available pack sizes: 2,5g.
Bis(2-bromopropan-2-yl)-dimethylsilane (CAS 55644-08-1) is a chemical compound with the molecular formula C8H18Br2Si and a molecular weight of 302.12 g/mol. IUPAC name: bis(2-bromopropan-2-yl)-dimethylsilane. InChIKey: YSQFNOLSKLSIHZ-UHFFFAOYSA-N.
| Molecular formula | C8H18Br2Si |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | bis(2-bromopropan-2-yl)-dimethylsilane |
| InChIKey | YSQFNOLSKLSIHZ-UHFFFAOYSA-N |
| SMILES | CC(C)([Si](C)(C)C(C)(C)Br)Br |
Computed by PubChem (NCBI)