CAS 557-07-3 appears in our catalog under these names: ZINC OLEATE, 98%, 98%, 9-Octadecenoic acid (9Z)-, zinc salt 2:1, Zinc(II) oleate 98%, Zinc(II) oleate, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 500g, 1kg, 1000g.
Zinc bis((Z)-octadec-9-enoate) (CAS 557-07-3) is a chemical compound with the molecular formula C36H66O4Zn and a molecular weight of 628.3 g/mol. IUPAC name: zinc bis((Z)-octadec-9-enoate). InChIKey: LPEBYPDZMWMCLZ-CVBJKYQLSA-L.
| Molecular formula | C36H66O4Zn |
|---|---|
| Molecular weight | 628.3 g/mol |
| IUPAC name | zinc bis((Z)-octadec-9-enoate) |
| InChIKey | LPEBYPDZMWMCLZ-CVBJKYQLSA-L |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)