CAS 55707-55-6 appears in our catalog under these names: Di(2–thiazolyl)methanone, Di(2-thiazolyl)methanone 95%, Di(2-thiazolyl)methanone, 95%, 95%, DI(2-THIAZOLYL)METHANONE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Bis(1,3-thiazol-2-yl)methanone (CAS 55707-55-6) is a chemical compound with the molecular formula C7H4N2OS2 and a molecular weight of 196.3 g/mol. IUPAC name: bis(1,3-thiazol-2-yl)methanone. InChIKey: JNWGVJCGMNPJHV-UHFFFAOYSA-N.
| Molecular formula | C7H4N2OS2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | bis(1,3-thiazol-2-yl)methanone |
| InChIKey | JNWGVJCGMNPJHV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C(=O)C2=NC=CS2 |
Computed by PubChem (NCBI)