CAS 55720-37-1 appears in our catalog under these names: 1,3,7-Trichloronaphthalene, 95%, 1,3,7-Trichloronaphthalene, >95% (HPLC), 1,3,7-Trichloronaphthalene. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 5000mg.
1,3,7-trichloronaphthalene (CAS 55720-37-1) is a chemical compound with the molecular formula C10H5Cl3 and a molecular weight of 231.5 g/mol. IUPAC name: 1,3,7-trichloronaphthalene. InChIKey: CFEUGIGSIREATC-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | 1,3,7-trichloronaphthalene |
| InChIKey | CFEUGIGSIREATC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)Cl)Cl)Cl |
Computed by PubChem (NCBI)