CAS 55727-10-1 appears in our catalog under these names: MESG (7–methyl–6–Thioguanosine), 7-Methyl-6-thioguanosine inner salt, ≥99%, ≥99%, 7-Methyl-6-thioguanosine, 99.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10 mg, 5 mg, 25 mg.
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methylpurin-9-ium-6-thiolate (CAS 55727-10-1) is a chemical compound with the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methylpurin-9-ium-6-thiolate. InChIKey: RFHIWBUKNJIBSE-KQYNXXCUSA-N.
| Molecular formula | C11H15N5O4S |
|---|---|
| Molecular weight | 313.34 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methylpurin-9-ium-6-thiolate |
| InChIKey | RFHIWBUKNJIBSE-KQYNXXCUSA-N |
| SMILES | CN1C=[N+](C2=C1C(=NC(=N2)N)[S-])[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)