CAS 5573-31-9 is the registry number for 3-Chloroacenaphthene. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
3-chloro-1,2-dihydroacenaphthylene (CAS 5573-31-9) is a chemical compound with the molecular formula C12H9Cl and a molecular weight of 188.65 g/mol. IUPAC name: 3-chloro-1,2-dihydroacenaphthylene. InChIKey: ACBQLXLMWUXKHR-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | 3-chloro-1,2-dihydroacenaphthylene |
| InChIKey | ACBQLXLMWUXKHR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2C1=CC=C3)Cl |
Computed by PubChem (NCBI)