CAS 55738-75-5 appears in our catalog under these names: 2,5-Dihydro-3-(hydroxymethyl)-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy, 97+%, 3-Hydroxymethyl-(1-oxy-2,2,5,5-tetramethylpyrroline). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg.
CAS 55738-75-5 identifies a chemical compound with the molecular formula C9H16NO2 and a molecular weight of 170.23 g/mol. InChIKey: NCMGONIKCPXQRB-UHFFFAOYSA-N.
| Molecular formula | C9H16NO2 |
|---|---|
| Molecular weight | 170.23 g/mol |
| InChIKey | NCMGONIKCPXQRB-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C(N1[O])(C)C)CO)C |
Computed by PubChem (NCBI)