CAS 5575-03-1 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxy-3-nitrophenyl)propanoic acid, 97%, Boc–3–Nitro–Tyrosine. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100g, 25g.
(2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 5575-03-1) is a chemical compound with the molecular formula C14H18N2O7 and a molecular weight of 326.30 g/mol. IUPAC name: (2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WKOHDYUJJUVBQB-VIFPVBQESA-N.
| Molecular formula | C14H18N2O7 |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | (2S)-3-(4-hydroxy-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WKOHDYUJJUVBQB-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)