CAS 55750-06-6 appears in our catalog under these names: Imidocarb Dipropionate, Imidocarb Dipropionate, >95% (HPLC), Imidocarb dipropionate 1000 µg/mL in Acetonitrile, Imidocarb (propionate), Imidocarb dipropionate/ 99.87% (existing batch purity). Offered by: Chemat Brand, TRC, LoGiCal, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 100mg, 500mg, 50mg, 10mg, 1ml, 1g, 10g.
1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;propanoic acid (CAS 55750-06-6) is a chemical compound with the molecular formula C25H32N6O5 and a molecular weight of 496.6 g/mol. IUPAC name: 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;propanoic acid. InChIKey: AFGQXWSHYUHHNV-UHFFFAOYSA-N.
| Molecular formula | C25H32N6O5 |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;propanoic acid |
| InChIKey | AFGQXWSHYUHHNV-UHFFFAOYSA-N |
| SMILES | CCC(=O)O.CCC(=O)O.C1CN=C(N1)C2=CC(=CC=C2)NC(=O)NC3=CC=CC(=C3)C4=NCCN4 |
Computed by PubChem (NCBI)