CAS 55755-07-2 is the registry number for 3,3-Dimethyl-2-butanol-d3. Offered by: TRC. Available pack sizes: 25mg.
1,1,1-trideuterio-3,3-dimethylbutan-2-ol (CAS 55755-07-2) is a chemical compound with the molecular formula C6H14O and a molecular weight of 105.19 g/mol. IUPAC name: 1,1,1-trideuterio-3,3-dimethylbutan-2-ol. InChIKey: DFOXKPDFWGNLJU-FIBGUPNXSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 105.19 g/mol |
| IUPAC name | 1,1,1-trideuterio-3,3-dimethylbutan-2-ol |
| InChIKey | DFOXKPDFWGNLJU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(C)(C)C)O |
Computed by PubChem (NCBI)