CAS 55767-12-9 is the registry number for Tributyl(methyl)phosphonium 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methylbenzenesulfonate;tributyl(methyl)phosphanium (CAS 55767-12-9) is a chemical compound with the molecular formula C20H37O3PS and a molecular weight of 388.5 g/mol. IUPAC name: 4-methylbenzenesulfonate;tributyl(methyl)phosphanium. InChIKey: VWIXDAMPMRGBBN-UHFFFAOYSA-M.
| Molecular formula | C20H37O3PS |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;tributyl(methyl)phosphanium |
| InChIKey | VWIXDAMPMRGBBN-UHFFFAOYSA-M |
| SMILES | CCCC[P+](C)(CCCC)CCCC.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)