Products 55785-86-9

CAS 55785-86-9 is the registry number for 3-(3,5-Di(pyridin-4-yl)-1H-1,2,4-triazol-1-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,5-dipyridin-4-yl-1,2,4-triazol-1-yl)propanoic acid (CAS 55785-86-9) is a chemical compound with the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. IUPAC name: 3-(3,5-dipyridin-4-yl-1,2,4-triazol-1-yl)propanoic acid. InChIKey: ZCVFWMYIWVBJIG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13N5O2
Molecular weight295.30 g/mol
IUPAC name3-(3,5-dipyridin-4-yl-1,2,4-triazol-1-yl)propanoic acid
InChIKeyZCVFWMYIWVBJIG-UHFFFAOYSA-N
SMILESC1=CN=CC=C1C2=NN(C(=N2)C3=CC=NC=C3)CCC(=O)O

Computed by PubChem (NCBI)