CAS 55786-24-8 is the registry number for 7,8-Dehydrorutecarpine. Offered by: Chemat Brand. Available pack sizes: on request.
3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,11,15,17,19-nonaen-14-one (CAS 55786-24-8) is a chemical compound with the molecular formula C18H11N3O and a molecular weight of 285.3 g/mol. IUPAC name: 3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,11,15,17,19-nonaen-14-one. InChIKey: KLONOPPMRIDVGM-UHFFFAOYSA-N.
| Molecular formula | C18H11N3O |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,11,15,17,19-nonaen-14-one |
| InChIKey | KLONOPPMRIDVGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=NC5=CC=CC=C5C(=O)N4C=C3 |
Computed by PubChem (NCBI)