CAS 558-89-4 is the registry number for 1-Chlorononafluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS 558-89-4) is a chemical compound with the molecular formula C4ClF9 and a molecular weight of 254.48 g/mol. IUPAC name: 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane. InChIKey: GIUDNRMHWCAPGM-UHFFFAOYSA-N.
| Molecular formula | C4ClF9 |
|---|---|
| Molecular weight | 254.48 g/mol |
| IUPAC name | 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| InChIKey | GIUDNRMHWCAPGM-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Cl)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)