CAS 55810-76-9 is the registry number for (5-Fluoro-1-benzothiophen-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-fluoro-1-benzothiophen-2-yl)methanamine;hydrochloride (CAS 55810-76-9) is a chemical compound with the molecular formula C9H9ClFNS and a molecular weight of 217.69 g/mol. IUPAC name: (5-fluoro-1-benzothiophen-2-yl)methanamine;hydrochloride. InChIKey: PQGVKSGPPAIUIC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNS |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (5-fluoro-1-benzothiophen-2-yl)methanamine;hydrochloride |
| InChIKey | PQGVKSGPPAIUIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C=C(S2)CN.Cl |
Computed by PubChem (NCBI)