Products 55812-80-1
CAS 55812-80-1 appears in our catalog under these names: Ergocalciferol (Vitamin D2) Impurity 1 (Windaus Ketone), Windaus ketone, 98%, Windaus Ketone, Windaus ketone, Windaus ketone, 98.37%. Offered by: Chemat Brand, AmBeed, TRC, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 25mg, 50mg, 2mg, 10mg, 5mg, 10mM (in 1ml dmso).
(1R,3aR,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (CAS 55812-80-1) is a chemical compound with the molecular formula C19H32O and a molecular weight of 276.5 g/mol. IUPAC name: (1R,3aR,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one. InChIKey: VJIOBQLKFJUZJB-IBOOZMTFSA-N.
| Molecular formula | C19H32O |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | (1R,3aR,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| InChIKey | VJIOBQLKFJUZJB-IBOOZMTFSA-N |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CCCC2=O)C |
Computed by PubChem (NCBI)