CAS 55821-72-2 is the registry number for (+)-Cytisine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
(1S,9R)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (CAS 55821-72-2) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (1S,9R)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one. InChIKey: ANJTVLIZGCUXLD-BDAKNGLRSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (1S,9R)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| InChIKey | ANJTVLIZGCUXLD-BDAKNGLRSA-N |
| SMILES | C1[C@@H]2CNC[C@H]1C3=CC=CC(=O)N3C2 |
Computed by PubChem (NCBI)