CAS 5585-71-7 is the registry number for Benzindopyrine Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
1-benzyl-3-(2-pyridin-4-ylethyl)indole;hydrochloride (CAS 5585-71-7) is a chemical compound with the molecular formula C22H21ClN2 and a molecular weight of 348.9 g/mol. IUPAC name: 1-benzyl-3-(2-pyridin-4-ylethyl)indole;hydrochloride. InChIKey: FPHIGGMDBMWPDB-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN2 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | 1-benzyl-3-(2-pyridin-4-ylethyl)indole;hydrochloride |
| InChIKey | FPHIGGMDBMWPDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)CCC4=CC=NC=C4.Cl |
Computed by PubChem (NCBI)