CAS 55851-37-1 is the registry number for N-(4-Chloro-3-nitrophenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(4-chloro-3-nitrophenyl)benzenesulfonamide (CAS 55851-37-1) is a chemical compound with the molecular formula C12H9ClN2O4S and a molecular weight of 312.73 g/mol. IUPAC name: N-(4-chloro-3-nitrophenyl)benzenesulfonamide. InChIKey: OAEWODJOQXHPGS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O4S |
|---|---|
| Molecular weight | 312.73 g/mol |
| IUPAC name | N-(4-chloro-3-nitrophenyl)benzenesulfonamide |
| InChIKey | OAEWODJOQXHPGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)