Products 55854-47-2

CAS 55854-47-2 appears in our catalog under these names: 5-Iodothiophene-2-sulfonyl chloride, 5-Iodothiophene-2-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

5-iodothiophene-2-sulfonyl chloride (CAS 55854-47-2) is a chemical compound with the molecular formula C4H2ClIO2S2 and a molecular weight of 308.5 g/mol. IUPAC name: 5-iodothiophene-2-sulfonyl chloride. InChIKey: ZPSQHBAYQRJYDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2ClIO2S2
Molecular weight308.5 g/mol
IUPAC name5-iodothiophene-2-sulfonyl chloride
InChIKeyZPSQHBAYQRJYDZ-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)I)S(=O)(=O)Cl

Computed by PubChem (NCBI)