Products 55862-52-7

CAS 55862-52-7 appears in our catalog under these names: [(1-Methyl-1h-tetrazol-5-yl)thio]acetic acid, 95%, (1-Methyl-1H -tetrazol-5-ylsulfanyl)-acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-(1-methyltetrazol-5-yl)sulfanylacetic acid (CAS 55862-52-7) is a chemical compound with the molecular formula C4H6N4O2S and a molecular weight of 174.18 g/mol. IUPAC name: 2-(1-methyltetrazol-5-yl)sulfanylacetic acid. InChIKey: SAKPCQKTTXWGQA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6N4O2S
Molecular weight174.18 g/mol
IUPAC name2-(1-methyltetrazol-5-yl)sulfanylacetic acid
InChIKeySAKPCQKTTXWGQA-UHFFFAOYSA-N
SMILESCN1C(=NN=N1)SCC(=O)O

Computed by PubChem (NCBI)