Products 55899-44-0

CAS 55899-44-0 is the registry number for 2-Methylindolin-7-amine, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 250mg, 1g, on request.

Structural formula: {0} (CAS {1})

2-methyl-2,3-dihydro-1H-indol-7-amine (CAS 55899-44-0) is a chemical compound with the molecular formula C9H12N2 and a molecular weight of 148.20 g/mol. IUPAC name: 2-methyl-2,3-dihydro-1H-indol-7-amine. InChIKey: WRUMBVIRYZTYPK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2
Molecular weight148.20 g/mol
IUPAC name2-methyl-2,3-dihydro-1H-indol-7-amine
InChIKeyWRUMBVIRYZTYPK-UHFFFAOYSA-N
SMILESCC1CC2=C(N1)C(=CC=C2)N

Computed by PubChem (NCBI)