CAS 559-37-5 is the registry number for 2-(Heptafluoropropyl)benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-benzimidazole (CAS 559-37-5) is a chemical compound with the molecular formula C10H5F7N2 and a molecular weight of 286.15 g/mol. IUPAC name: 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-benzimidazole. InChIKey: VZEYKZFVOPCTLV-UHFFFAOYSA-N.
| Molecular formula | C10H5F7N2 |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-benzimidazole |
| InChIKey | VZEYKZFVOPCTLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)