CAS 559-40-0 appears in our catalog under these names: Octafluorocyclopentene, >95% (GC), Octafluorocyclopentene, Octafluorocyclopentene, >98.0%(GC). Offered by: TRC, GLPBio, TCI. Available pack sizes: 100mg, 1g, 500mg, 5g, 50g.
1,2,3,3,4,4,5,5-octafluorocyclopentene (CAS 559-40-0) is a chemical compound with the molecular formula C5F8 and a molecular weight of 212.04 g/mol. IUPAC name: 1,2,3,3,4,4,5,5-octafluorocyclopentene. InChIKey: YBMDPYAEZDJWNY-UHFFFAOYSA-N.
| Molecular formula | C5F8 |
|---|---|
| Molecular weight | 212.04 g/mol |
| IUPAC name | 1,2,3,3,4,4,5,5-octafluorocyclopentene |
| InChIKey | YBMDPYAEZDJWNY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(C(C1(F)F)(F)F)(F)F)F)F |
Computed by PubChem (NCBI)