CAS 5590-14-7 is the registry number for rac-(1R,2R)-2-Phenylcyclopropane-1-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1R,2R)-2-phenylcyclopropane-1-carbonitrile (CAS 5590-14-7) is a chemical compound with the molecular formula C10H9N and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,2R)-2-phenylcyclopropane-1-carbonitrile. InChIKey: KUCVFITUDJTMFA-UWVGGRQHSA-N.
| Molecular formula | C10H9N |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylcyclopropane-1-carbonitrile |
| InChIKey | KUCVFITUDJTMFA-UWVGGRQHSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)